C18H27F3N4O3 — CID 111383155
N-tert-butyl-2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111383155) has the molecular formula C18H27F3N4O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383155 |
| Molecular Formula | C18H27F3N4O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-tert-butyl-2-[[N-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C18H27F3N4O3/c1-17(2,3)25-15(26)10-24-16(22-4)23-9-12-6-7-13(14(8-12)27-5)28-11-18(19,20)21/h6-8H,9-11H2,1-5H3,(H,25,26)(H2,22,23,24) |
| InChIKey | WKTHUYKZMQUKBO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|