C18H31IN4O3 — CID 110964136
2-[4-[[(N-tert-butyl-N'-methylcarbamimidoyl)amino]methyl]-2-methoxyphenoxy]-N-ethylacetamide;hydroiodide (PubChem CID 110964136) has the molecular formula C18H31IN4O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is 2-[4-[[(N-tert-butyl-N'-methylcarbamimidoyl)amino]methyl]-2-methoxyphenoxy]-N-ethylacetamide;hydroiodide.
| Compound Name | 2-[4-[[(N-tert-butyl-N'-methylcarbamimidoyl)amino]methyl]-2-methoxyphenoxy]-N-ethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110964136 |
| Molecular Formula | C18H31IN4O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[4-[[(N-tert-butyl-N'-methylcarbamimidoyl)amino]methyl]-2-methoxyphenoxy]-N-ethylacetamide;hydroiodide |
| SMILES | CCNC(=O)COc1ccc(CN/C(=N/C)NC(C)(C)C)cc1OC.I |
| InChI | InChI=1S/C18H30N4O3.HI/c1-7-20-16(23)12-25-14-9-8-13(10-15(14)24-6)11-21-17(19-5)22-18(2,3)4;/h8-10H,7,11-12H2,1-6H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | GVIAEIQUIORIJH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|