C19H21ClF3N3O2 — CID 111176806
1-[(3-chlorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111176806) has the molecular formula C19H21ClF3N3O2 and a molecular weight of 415.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111176806 |
| Molecular Formula | C19H21ClF3N3O2 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cccc(Cl)c1)NCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C19H21ClF3N3O2/c1-24-18(25-10-13-4-3-5-15(20)8-13)26-11-14-6-7-16(17(9-14)27-2)28-12-19(21,22)23/h3-9H,10-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | GXCOUOYHWRVIPY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|