C20H34N6O — CID 111767665
2-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide (PubChem CID 111767665) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111767665 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 2-[[N-[[2-(azepan-1-yl)-4-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccnc(N2CCCCCC2)c1 |
| InChI | InChI=1S/C20H34N6O/c1-20(2,3)25-18(27)15-24-19(21-4)23-14-16-9-10-22-17(13-16)26-11-7-5-6-8-12-26/h9-10,13H,5-8,11-12,14-15H2,1-4H3,(H,25,27)(H2,21,23,24) |
| InChIKey | KKICNKOCWHCTAF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|