C17H27F3IN5O3 — CID 111885332
tert-butyl N-[2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885332) has the molecular formula C17H27F3IN5O3 and a molecular weight of 533.33 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885332 |
| Molecular Formula | C17H27F3IN5O3 |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1ccnc(OCC(F)(F)F)c1.I |
| InChI | InChI=1S/C17H26F3N5O3.HI/c1-16(2,3)28-15(26)24-8-7-23-14(21-4)25-10-12-5-6-22-13(9-12)27-11-17(18,19)20;/h5-6,9H,7-8,10-11H2,1-4H3,(H,24,26)(H2,21,23,25);1H |
| InChIKey | DONUXCHLMLUUEM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|