C14H21F3N4O2 — CID 110973217
1-(3-methoxypropyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 110973217) has the molecular formula C14H21F3N4O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-methoxypropyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110973217 |
| Molecular Formula | C14H21F3N4O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(3-methoxypropyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(\NCCCOC)NCc1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H21F3N4O2/c1-18-13(20-5-3-7-22-2)21-9-11-4-6-19-12(8-11)23-10-14(15,16)17/h4,6,8H,3,5,7,9-10H2,1-2H3,(H2,18,20,21) |
| InChIKey | CUWMHHJDLPEZST-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|