C15H16F6IN5OS — CID 111617489
2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617489) has the molecular formula C15H16F6IN5OS and a molecular weight of 555.29 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617489 |
| Molecular Formula | C15H16F6IN5OS |
| Molecular Weight | 555.29 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(OCC(F)(F)F)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H15F6N5OS.HI/c1-22-13(25-6-12-26-10(7-28-12)15(19,20)21)24-5-9-2-3-23-11(4-9)27-8-14(16,17)18;/h2-4,7H,5-6,8H2,1H3,(H2,22,24,25);1H |
| InChIKey | QSSGMQBVTKWVCG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|