C15H15F6N5OS — CID 111617492
2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617492) has the molecular formula C15H15F6N5OS and a molecular weight of 427.37 g/mol. Its IUPAC name is 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617492 |
| Molecular Formula | C15H15F6N5OS |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-methyl-1-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(C(F)(F)F)cs1)NCc1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C15H15F6N5OS/c1-22-13(25-6-11-26-10(7-28-11)15(19,20)21)24-5-9-3-2-4-23-12(9)27-8-14(16,17)18/h2-4,7H,5-6,8H2,1H3,(H2,22,24,25) |
| InChIKey | QJCBECOPIFVWBJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|