C14H19F3N4O — CID 111867448
1-(cyclopropylmethyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111867448) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(cyclopropylmethyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111867448 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1OCC(F)(F)F)NCC1CC1 |
| InChI | InChI=1S/C14H19F3N4O/c1-18-13(20-7-10-4-5-10)21-8-11-3-2-6-19-12(11)22-9-14(15,16)17/h2-3,6,10H,4-5,7-9H2,1H3,(H2,18,20,21) |
| InChIKey | YAXRBZMUXNMVND-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|