C17H26F3N5O — CID 111262789
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111262789) has the molecular formula C17H26F3N5O and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111262789 |
| Molecular Formula | C17H26F3N5O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN1CCCC1CN/C(=N\C)NCc1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C17H26F3N5O/c1-3-25-9-5-7-14(25)11-24-16(21-2)23-10-13-6-4-8-22-15(13)26-12-17(18,19)20/h4,6,8,14H,3,5,7,9-12H2,1-2H3,(H2,21,23,24) |
| InChIKey | ZKWRMDAHJMHWTL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|