C18H28F3N5O2 — CID 111315684
2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111315684) has the molecular formula C18H28F3N5O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111315684 |
| Molecular Formula | C18H28F3N5O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1OCC(F)(F)F)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C18H28F3N5O2/c1-17(2,26-7-9-27-10-8-26)12-25-16(22-3)24-11-14-5-4-6-23-15(14)28-13-18(19,20)21/h4-6H,7-13H2,1-3H3,(H2,22,24,25) |
| InChIKey | MFJNCDTWKPSDDQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|