C15H23F3N4OS — CID 111611550
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111611550) has the molecular formula C15H23F3N4OS and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111611550 |
| Molecular Formula | C15H23F3N4OS |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccnc1OCC(F)(F)F)NCC(C)(C)SC |
| InChI | InChI=1S/C15H23F3N4OS/c1-14(2,24-4)9-22-13(19-3)21-8-11-6-5-7-20-12(11)23-10-15(16,17)18/h5-7H,8-10H2,1-4H3,(H2,19,21,22) |
| InChIKey | DGPOUWBRDRQWDX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|