C21H24F3IN6O — CID 111851431
2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111851431) has the molecular formula C21H24F3IN6O and a molecular weight of 560.36 g/mol. Its IUPAC name is 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851431 |
| Molecular Formula | C21H24F3IN6O |
| Molecular Weight | 560.36 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1Cn1cccn1)NCc1cccnc1OCC(F)(F)F.I |
| InChI | InChI=1S/C21H23F3N6O.HI/c1-25-20(28-13-17-8-4-9-26-19(17)31-15-21(22,23)24)27-12-16-6-2-3-7-18(16)14-30-11-5-10-29-30;/h2-11H,12-15H2,1H3,(H2,25,27,28);1H |
| InChIKey | XWVGEDFELDYMNA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|