C16H17F6IN4OS — CID 111615512
2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615512) has the molecular formula C16H17F6IN4OS and a molecular weight of 554.30 g/mol. Its IUPAC name is 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615512 |
| Molecular Formula | C16H17F6IN4OS |
| Molecular Weight | 554.30 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | 2-methyl-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)(F)F)c1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H16F6N4OS.HI/c1-23-14(25-7-13-26-12(8-28-13)16(20,21)22)24-6-10-3-2-4-11(5-10)27-9-15(17,18)19;/h2-5,8H,6-7,9H2,1H3,(H2,23,24,25);1H |
| InChIKey | JOKIWCJFENVQDA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|