C16H20F3IN4OS — CID 111524897
2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111524897) has the molecular formula C16H20F3IN4OS and a molecular weight of 500.33 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524897 |
| Molecular Formula | C16H20F3IN4OS |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,3-thiazol-2-yl)methyl]-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)(F)F)c1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C16H19F3N4OS.HI/c1-11-7-21-14(25-11)9-23-15(20-2)22-8-12-4-3-5-13(6-12)24-10-16(17,18)19;/h3-7H,8-10H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | XMWZZZBVSYBDMO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|