C20H32IN5O2S — CID 111524395
1-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111524395) has the molecular formula C20H32IN5O2S and a molecular weight of 533.48 g/mol. Its IUPAC name is 1-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111524395 |
| Molecular Formula | C20H32IN5O2S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 1-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCCN(C)CCOC)c1)NCc1ncc(C)s1.I |
| InChI | InChI=1S/C20H31N5O2S.HI/c1-16-13-22-19(28-16)15-24-20(21-2)23-14-17-6-5-7-18(12-17)27-11-9-25(3)8-10-26-4;/h5-7,12-13H,8-11,14-15H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | HROAHZAQUBEXIE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|