C19H28N6OS — CID 111524716
N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111524716) has the molecular formula C19H28N6OS and a molecular weight of 388.54 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111524716 |
| Molecular Formula | C19H28N6OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCCN(C)C)c1)NCc1ncc(C)s1 |
| InChI | InChI=1S/C19H28N6OS/c1-14-11-22-17(27-14)13-24-19(20-2)23-12-15-6-5-7-16(10-15)18(26)21-8-9-25(3)4/h5-7,10-11H,8-9,12-13H2,1-4H3,(H,21,26)(H2,20,23,24) |
| InChIKey | YSBWYWBTMQEYOB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|