C23H34IN5O — CID 111937656
N-[2-(dimethylamino)ethyl]-3-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111937656) has the molecular formula C23H34IN5O and a molecular weight of 523.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111937656 |
| Molecular Formula | C23H34IN5O |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N-[(2,4-dimethylphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCCN(C)C)c1)NCc1ccc(C)cc1C.I |
| InChI | InChI=1S/C23H33N5O.HI/c1-17-9-10-21(18(2)13-17)16-27-23(24-3)26-15-19-7-6-8-20(14-19)22(29)25-11-12-28(4)5;/h6-10,13-14H,11-12,15-16H2,1-5H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | UGZIGBHWXIFXEE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|