C25H34N6O — CID 111974062
N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[2-(6-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111974062) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[2-(6-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[2-(6-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111974062 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[2-(6-methyl-1H-indol-3-yl)ethyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCc1cccc(C(=O)NCCN(C)C)c1 |
| InChI | InChI=1S/C25H34N6O/c1-18-8-9-22-21(17-29-23(22)14-18)10-11-28-25(26-2)30-16-19-6-5-7-20(15-19)24(32)27-12-13-31(3)4/h5-9,14-15,17,29H,10-13,16H2,1-4H3,(H,27,32)(H2,26,28,30) |
| InChIKey | BAINDZRSCMBQDL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|