C18H28N8O — CID 111708203
N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111708203) has the molecular formula C18H28N8O and a molecular weight of 372.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111708203 |
| Molecular Formula | C18H28N8O |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCCN(C)C)c1)NCc1ncnn1C |
| InChI | InChI=1S/C18H28N8O/c1-19-18(22-12-16-23-13-24-26(16)4)21-11-14-6-5-7-15(10-14)17(27)20-8-9-25(2)3/h5-7,10,13H,8-9,11-12H2,1-4H3,(H,20,27)(H2,19,21,22) |
| InChIKey | NJQJXUBZMJUKNG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|