C19H26F3IN4O2 — CID 111592960
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111592960) has the molecular formula C19H26F3IN4O2 and a molecular weight of 526.34 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592960 |
| Molecular Formula | C19H26F3IN4O2 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)(F)F)c1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C19H25F3N4O2.HI/c1-18(2,3)15-10-24-16(28-15)11-26-17(23-4)25-9-13-6-5-7-14(8-13)27-12-19(20,21)22;/h5-8,10H,9,11-12H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | RXTBPWMWJBVQIL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|