C20H28F3IN4O2 — CID 111595112
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111595112) has the molecular formula C20H28F3IN4O2 and a molecular weight of 540.37 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111595112 |
| Molecular Formula | C20H28F3IN4O2 |
| Molecular Weight | 540.37 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(COCC(F)(F)F)cc1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C20H27F3N4O2.HI/c1-19(2,3)16-10-25-17(29-16)11-27-18(24-4)26-9-14-5-7-15(8-6-14)12-28-13-20(21,22)23;/h5-8,10H,9,11-13H2,1-4H3,(H2,24,26,27);1H |
| InChIKey | SOJUXOVVJNXTAM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|