C19H26F3N5O2 — CID 111621384
1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111621384) has the molecular formula C19H26F3N5O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111621384 |
| Molecular Formula | C19H26F3N5O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(COCC(F)(F)F)cc1)NCc1noc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H26F3N5O2/c1-18(2,3)16-26-15(27-29-16)10-25-17(23-4)24-9-13-5-7-14(8-6-13)11-28-12-19(20,21)22/h5-8H,9-12H2,1-4H3,(H2,23,24,25) |
| InChIKey | XBQIBLJGMYXKHW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|