C15H20F6IN3O — CID 111999948
2-methyl-1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111999948) has the molecular formula C15H20F6IN3O and a molecular weight of 499.24 g/mol. Its IUPAC name is 2-methyl-1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111999948 |
| Molecular Formula | C15H20F6IN3O |
| Molecular Weight | 499.24 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-methyl-1-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C15H19F6N3O.HI/c1-22-13(23-7-6-14(16,17)18)24-8-11-2-4-12(5-3-11)9-25-10-15(19,20)21;/h2-5H,6-10H2,1H3,(H2,22,23,24);1H |
| InChIKey | OAICXQPQZOLLFH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.24 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|