C20H23F4N3O — CID 111396529
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111396529) has the molecular formula C20H23F4N3O and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111396529 |
| Molecular Formula | C20H23F4N3O |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F4N3O/c1-25-19(26-10-9-15-3-2-4-18(21)11-15)27-12-16-5-7-17(8-6-16)13-28-14-20(22,23)24/h2-8,11H,9-10,12-14H2,1H3,(H2,25,26,27) |
| InChIKey | FWEWUSUPEQBTAG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|