C21H36F3IN4O — CID 111692331
1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111692331) has the molecular formula C21H36F3IN4O and a molecular weight of 544.44 g/mol. Its IUPAC name is 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111692331 |
| Molecular Formula | C21H36F3IN4O |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 1-[3-[di(propan-2-yl)amino]propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C(C)C)C(C)C)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C21H35F3N4O.HI/c1-16(2)28(17(3)4)12-6-11-26-20(25-5)27-13-18-7-9-19(10-8-18)14-29-15-21(22,23)24;/h7-10,16-17H,6,11-15H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | BDIVYVPDHHBKOP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|