C18H26F3N3O3 — CID 111857761
ethyl 4-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]butanoate (PubChem CID 111857761) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111857761 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)NCc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F3N3O3/c1-3-27-16(25)5-4-10-23-17(22-2)24-11-14-6-8-15(9-7-14)12-26-13-18(19,20)21/h6-9H,3-5,10-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | SEPLQHPYOAUJCX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|