C16H26F3IN4O3S — CID 111856515
1-[3-(methanesulfonamido)propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111856515) has the molecular formula C16H26F3IN4O3S and a molecular weight of 538.37 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111856515 |
| Molecular Formula | C16H26F3IN4O3S |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C16H25F3N4O3S.HI/c1-20-15(21-8-3-9-23-27(2,24)25)22-10-13-4-6-14(7-5-13)11-26-12-16(17,18)19;/h4-7,23H,3,8-12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | VMXDNLYPAAKIKS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|