C20H25F3IN5O3 — CID 111857081
2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111857081) has the molecular formula C20H25F3IN5O3 and a molecular weight of 567.35 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111857081 |
| Molecular Formula | C20H25F3IN5O3 |
| Molecular Weight | 567.35 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)NCc1ccc(COCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C20H24F3N5O3.HI/c1-24-19(26-11-10-25-17-6-8-18(9-7-17)28(29)30)27-12-15-2-4-16(5-3-15)13-31-14-20(21,22)23;/h2-9,25H,10-14H2,1H3,(H2,24,26,27);1H |
| InChIKey | OKGZJUCOBNFHAJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|