C18H22IN5O4 — CID 111844259
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111844259) has the molecular formula C18H22IN5O4 and a molecular weight of 499.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111844259 |
| Molecular Formula | C18H22IN5O4 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[2-(4-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccc([N+](=O)[O-])cc1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C18H21N5O4.HI/c1-19-18(22-11-13-2-7-16-17(10-13)27-12-26-16)21-9-8-20-14-3-5-15(6-4-14)23(24)25;/h2-7,10,20H,8-9,11-12H2,1H3,(H2,19,21,22);1H |
| InChIKey | VMMWAVBXYITMMC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|