C21H29IN4O3 — CID 111380933
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111380933) has the molecular formula C21H29IN4O3 and a molecular weight of 512.39 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111380933 |
| Molecular Formula | C21H29IN4O3 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCc1ccc(NCCOC)cc1.I |
| InChI | InChI=1S/C21H28N4O3.HI/c1-22-21(24-10-9-16-5-8-19-20(13-16)28-15-27-19)25-14-17-3-6-18(7-4-17)23-11-12-26-2;/h3-8,13,23H,9-12,14-15H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | GPWOWVGSHOMAPQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|