C18H21IN4O4 — CID 111845196
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111845196) has the molecular formula C18H21IN4O4 and a molecular weight of 484.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845196 |
| Molecular Formula | C18H21IN4O4 |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C18H20N4O4.HI/c1-2-19-18(20-10-13-3-6-15(7-4-13)22(23)24)21-11-14-5-8-16-17(9-14)26-12-25-16;/h3-9H,2,10-12H2,1H3,(H2,19,20,21);1H |
| InChIKey | JQAURZRVXZJIDC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|