C22H30IN5O3 — CID 111845170
1-[4-[[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide (PubChem CID 111845170) has the molecular formula C22H30IN5O3 and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-[4-[[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide.
| Compound Name | 1-[4-[[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
|---|---|
| PubChem CID | 111845170 |
| Molecular Formula | C22H30IN5O3 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 1-[4-[[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]methyl]phenyl]-3-propan-2-ylurea;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccc(NC(=O)NC(C)C)cc1.I |
| InChI | InChI=1S/C22H29N5O3.HI/c1-4-23-21(25-13-17-7-10-19-20(11-17)30-14-29-19)24-12-16-5-8-18(9-6-16)27-22(28)26-15(2)3;/h5-11,15H,4,12-14H2,1-3H3,(H2,23,24,25)(H2,26,27,28);1H |
| InChIKey | WAYCDWUZKXEQSV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|