C18H23IN4O4S — CID 111844440
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111844440) has the molecular formula C18H23IN4O4S and a molecular weight of 518.38 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111844440 |
| Molecular Formula | C18H23IN4O4S |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCc1ccc(S(N)(=O)=O)cc1.I |
| InChI | InChI=1S/C18H22N4O4S.HI/c1-2-20-18(21-10-13-3-6-15(7-4-13)27(19,23)24)22-11-14-5-8-16-17(9-14)26-12-25-16;/h3-9H,2,10-12H2,1H3,(H2,19,23,24)(H2,20,21,22);1H |
| InChIKey | RQBJUXOSJSIRPT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|