C15H23N3O4S — CID 111844069
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-ethylsulfonylethyl)guanidine (PubChem CID 111844069) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-ethylsulfonylethyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-ethylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111844069 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-ethylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCS(=O)(=O)CC |
| InChI | InChI=1S/C15H23N3O4S/c1-3-16-15(17-7-8-23(19,20)4-2)18-10-12-5-6-13-14(9-12)22-11-21-13/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H2,16,17,18) |
| InChIKey | WDDNWLWJCKLSDX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|