C11H16N4O2 — CID 116511200
1-amino-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine (PubChem CID 116511200) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-amino-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine.
| Compound Name | 1-amino-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 116511200 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-amino-2-(1,3-benzodioxol-5-ylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NN |
| InChI | InChI=1S/C11H16N4O2/c1-2-13-11(15-12)14-6-8-3-4-9-10(5-8)17-7-16-9/h3-5H,2,6-7,12H2,1H3,(H2,13,14,15) |
| InChIKey | MAGRRAPCXVDKFL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|