C14H21N3O4S — CID 111843519
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111843519) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111843519 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-methylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCS(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O4S/c1-3-15-14(16-6-7-22(2,18)19)17-9-11-4-5-12-13(8-11)21-10-20-12/h4-5,8H,3,6-7,9-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | KEXWIPBWZNBJEG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|