C16H27IN4O4S — CID 111845946
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide (PubChem CID 111845946) has the molecular formula C16H27IN4O4S and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845946 |
| Molecular Formula | C16H27IN4O4S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCCNS(=O)(=O)CC.I |
| InChI | InChI=1S/C16H26N4O4S.HI/c1-3-17-16(18-8-5-9-20-25(21,22)4-2)19-11-13-6-7-14-15(10-13)24-12-23-14;/h6-7,10,20H,3-5,8-9,11-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | IOHNROOTQDCKRB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|