C19H31IN4O4 — CID 111843349
tert-butyl N-[3-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111843349) has the molecular formula C19H31IN4O4 and a molecular weight of 506.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111843349 |
| Molecular Formula | C19H31IN4O4 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | tert-butyl N-[3-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H30N4O4.HI/c1-5-20-17(21-9-6-10-22-18(24)27-19(2,3)4)23-12-14-7-8-15-16(11-14)26-13-25-15;/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | PCDMYVLSJKSWJI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|