C20H32ClIN4O4 — CID 111886442
tert-butyl N-[3-[[N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886442) has the molecular formula C20H32ClIN4O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is tert-butyl N-[3-[[N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886442 |
| Molecular Formula | C20H32ClIN4O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | tert-butyl N-[3-[[N'-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N-ethylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCO2)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H31ClN4O4.HI/c1-5-22-18(23-7-6-8-24-19(26)29-20(2,3)4)25-13-14-11-15(21)17-16(12-14)27-9-10-28-17;/h11-12H,5-10,13H2,1-4H3,(H,24,26)(H2,22,23,25);1H |
| InChIKey | BUKNJOFHBPJLDR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|