C15H23IN4O3 — CID 111843377
2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-ethylacetamide;hydroiodide (PubChem CID 111843377) has the molecular formula C15H23IN4O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-ethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-ethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111843377 |
| Molecular Formula | C15H23IN4O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-ethylacetamide;hydroiodide |
| SMILES | CCNC(=O)CN/C(=N/Cc1ccc2c(c1)OCO2)NCC.I |
| InChI | InChI=1S/C15H22N4O3.HI/c1-3-16-14(20)9-19-15(17-4-2)18-8-11-5-6-12-13(7-11)22-10-21-12;/h5-7H,3-4,8-10H2,1-2H3,(H,16,20)(H2,17,18,19);1H |
| InChIKey | FXVOFCLCJUDXCI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|