C21H27IN4O4 — CID 111844804
2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 111844804) has the molecular formula C21H27IN4O4 and a molecular weight of 526.38 g/mol. Its IUPAC name is 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111844804 |
| Molecular Formula | C21H27IN4O4 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 2-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-ethylcarbamimidoyl]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCC(=O)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C21H26N4O4.HI/c1-3-22-21(24-12-16-6-9-18-19(10-16)29-14-28-18)25-13-20(26)23-11-15-4-7-17(27-2)8-5-15;/h4-10H,3,11-14H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | CGXVBGZMIWZZKV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|