C21H26IN3O5 — CID 111843371
methyl 5-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111843371) has the molecular formula C21H26IN3O5 and a molecular weight of 527.36 g/mol. Its IUPAC name is methyl 5-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111843371 |
| Molecular Formula | C21H26IN3O5 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | methyl 5-[[[(1,3-benzodioxol-5-ylmethylamino)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C21H25N3O5.HI/c1-4-22-21(24-12-15-6-8-18-19(10-15)29-13-28-18)23-11-14-5-7-17(26-2)16(9-14)20(25)27-3;/h5-10H,4,11-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | HKVRRGOCCSMPRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|