C19H22BrN3O3 — CID 111844829
1-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromo-4-methoxyphenyl)methyl]-3-ethylguanidine (PubChem CID 111844829) has the molecular formula C19H22BrN3O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromo-4-methoxyphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromo-4-methoxyphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111844829 |
| Molecular Formula | C19H22BrN3O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-[(3-bromo-4-methoxyphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(Br)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22BrN3O3/c1-3-21-19(22-10-13-4-6-16(24-2)15(20)8-13)23-11-14-5-7-17-18(9-14)26-12-25-17/h4-9H,3,10-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | MDMITSCUGCXDHO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|