C23H33IN4O4 — CID 111845564
2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111845564) has the molecular formula C23H33IN4O4 and a molecular weight of 556.45 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111845564 |
| Molecular Formula | C23H33IN4O4 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCC(c1ccc(OC)c(OC)c1)N(C)C.I |
| InChI | InChI=1S/C23H32N4O4.HI/c1-6-24-23(25-13-16-7-9-20-22(11-16)31-15-30-20)26-14-18(27(2)3)17-8-10-19(28-4)21(12-17)29-5;/h7-12,18H,6,13-15H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | JVPOJRZARCHFLP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|