C20H25N3O3 — CID 111997701
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine (PubChem CID 111997701) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111997701 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-hydroxy-2-(4-methylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCC(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-21-20(23-12-17(24)16-7-4-14(2)5-8-16)22-11-15-6-9-18-19(10-15)26-13-25-18/h4-10,17,24H,3,11-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | WBXGRWLNESDNAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|