C20H25FIN3O3 — CID 111713835
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-(4-fluorophenyl)-2-methoxyethyl]guanidine;hydroiodide (PubChem CID 111713835) has the molecular formula C20H25FIN3O3 and a molecular weight of 501.34 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-(4-fluorophenyl)-2-methoxyethyl]guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-(4-fluorophenyl)-2-methoxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111713835 |
| Molecular Formula | C20H25FIN3O3 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[2-(4-fluorophenyl)-2-methoxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCC(OC)c1ccc(F)cc1.I |
| InChI | InChI=1S/C20H24FN3O3.HI/c1-3-22-20(23-11-14-4-9-17-18(10-14)27-13-26-17)24-12-19(25-2)15-5-7-16(21)8-6-15;/h4-10,19H,3,11-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | QWZLMWVPDPBUEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|