C19H23F3IN5O3 — CID 111871548
2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871548) has the molecular formula C19H23F3IN5O3 and a molecular weight of 553.32 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871548 |
| Molecular Formula | C19H23F3IN5O3 |
| Molecular Weight | 553.32 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)NCc1ccc(OCC(F)(F)F)cc1.I |
| InChI | InChI=1S/C19H22F3N5O3.HI/c1-23-18(25-11-10-24-15-4-6-16(7-5-15)27(28)29)26-12-14-2-8-17(9-3-14)30-13-19(20,21)22;/h2-9,24H,10-13H2,1H3,(H2,23,25,26);1H |
| InChIKey | ATPXEBCBZJXEMZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|