C13H19F3IN5O2 — CID 109474026
2-methyl-1-[2-(4-nitroanilino)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474026) has the molecular formula C13H19F3IN5O2 and a molecular weight of 461.23 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474026 |
| Molecular Formula | C13H19F3IN5O2 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 2-methyl-1-[2-(4-nitroanilino)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H18F3N5O2.HI/c1-17-12(19-7-6-13(14,15)16)20-9-8-18-10-2-4-11(5-3-10)21(22)23;/h2-5,18H,6-9H2,1H3,(H2,17,19,20);1H |
| InChIKey | MGHYYZBNHOFXJP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|