C10H16F3IN6O2 — CID 109474234
2-methyl-1-[2-(4-nitropyrazol-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474234) has the molecular formula C10H16F3IN6O2 and a molecular weight of 436.18 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-nitropyrazol-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-nitropyrazol-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474234 |
| Molecular Formula | C10H16F3IN6O2 |
| Molecular Weight | 436.18 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-methyl-1-[2-(4-nitropyrazol-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCn1cc([N+](=O)[O-])cn1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C10H15F3N6O2.HI/c1-14-9(15-3-2-10(11,12)13)16-4-5-18-7-8(6-17-18)19(20)21;/h6-7H,2-5H2,1H3,(H2,14,15,16);1H |
| InChIKey | JTNPMJHMTSBNHC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|